Products 10303-72-7
CAS 10303-72-7 is the registry number for (R)-2,6-Diaminohexanoic acid dihydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2R)-2,6-diaminohexanoic acid;dihydrochloride (CAS 10303-72-7) is a chemical compound with the molecular formula C6H16Cl2N2O2 and a molecular weight of 219.11 g/mol. IUPAC name: (2R)-2,6-diaminohexanoic acid;dihydrochloride. InChIKey: JBBURJFZIMRPCZ-ZJIMSODOSA-N.
| Molecular formula | C6H16Cl2N2O2 |
|---|---|
| Molecular weight | 219.11 g/mol |
| IUPAC name | (2R)-2,6-diaminohexanoic acid;dihydrochloride |
| InChIKey | JBBURJFZIMRPCZ-ZJIMSODOSA-N |
| SMILES | C(CCN)C[C@H](C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
Lysine dihydrochloride, D-, D-Lysine, dihydrochloride, Lysine, dihydrochloride, D-, H-D-Lys-OH.diHCl, D-LYSINE DIHYDROCHLORIDE, (2R)-2,6-diaminohexanoic acid;dihydrochloride, d-Lysindihydrochlorid, orb1985781, (R)-2,6-Diaminohexanoic acid dihydrochloride, (2R)-2,6-diaminohexanoic acid dihydrochloride