Products 284664-87-5
CAS 284664-87-5 appears in our catalog under these names: DL-Lysine-3,3,4,4,5,5,6,6-d8 2HCl, 98 atom % D, min 98% Chemical Purity, DL-Lysine-d8 (dihydrochloride). Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 5mg, 1mg.
2,6-diamino-3,3,4,4,5,5,6,6-octadeuteriohexanoic acid;dihydrochloride (CAS 284664-87-5) is a chemical compound with the molecular formula C6H16Cl2N2O2 and a molecular weight of 227.16 g/mol. IUPAC name: 2,6-diamino-3,3,4,4,5,5,6,6-octadeuteriohexanoic acid;dihydrochloride. InChIKey: JBBURJFZIMRPCZ-VHGLFXLXSA-N.
| Molecular formula | C6H16Cl2N2O2 |
|---|---|
| Molecular weight | 227.16 g/mol |
| IUPAC name | 2,6-diamino-3,3,4,4,5,5,6,6-octadeuteriohexanoic acid;dihydrochloride |
| InChIKey | JBBURJFZIMRPCZ-VHGLFXLXSA-N |
| SMILES | [2H]C([2H])(C(C(=O)O)N)C([2H])([2H])C([2H])([2H])C([2H])([2H])N.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
DL-Lysine-3,3,4,4,5,5,6,6-d8 dihydrochloride, 2,6-diamino-3,3,4,4,5,5,6,6-octadeuteriohexanoic acid;dihydrochloride, DL-Lysine-d8 (dihydrochloride), Dl-lysine-3,3,4,4,5,5,6,6-d8 2hcl, (3,3,4,4,5,5,6,6-~2~H_8_)Lysine--hydrogen chloride (1/2), DL-Lysine-3,3,4,4,5,5,6,6-d8 dihydrochloride, >=98 atom % D, >=99% (CP)