CAS 284664-88-6 appears in our catalog under these names: DL-Lysine-4,4,5,5-d4 2HCl, 98 atom % D, min 98% Chemical Purity, DL–Lysine–4,4,5,5–D4 dihydrochloride, DL-LYSINE-4,4,5,5-D4 DIHYDROCHLORIDE, &, DL-Lysine-d4 (dihydrochloride), 98.0%. Offered by: CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 100mg, 1G, 5 mg, 10 mg.
2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;dihydrochloride (CAS 284664-88-6) is a chemical compound with the molecular formula C6H16Cl2N2O2 and a molecular weight of 223.13 g/mol. IUPAC name: 2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;dihydrochloride. InChIKey: JBBURJFZIMRPCZ-RIZDZYNXSA-N.
| Molecular formula | C6H16Cl2N2O2 |
|---|---|
| Molecular weight | 223.13 g/mol |
| IUPAC name | 2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;dihydrochloride |
| InChIKey | JBBURJFZIMRPCZ-RIZDZYNXSA-N |
| SMILES | [2H]C([2H])(CC(C(=O)O)N)C([2H])([2H])CN.Cl.Cl |
Computed by PubChem (NCBI)