Products 2708340-91-2
CAS 2708340-91-2 appears in our catalog under these names: D-Lysine-4,4,5,5-d4 2HCl, 98 atom % D, min 98% Chemical Purity, D–Lysine–d4 dihydrochloride, D-Lysine-d4 (dihydrochloride). Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1mg, 10mg, 5mg, 1 mg.
(2R)-2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;dihydrochloride (CAS 2708340-91-2) is a chemical compound with the molecular formula C6H16Cl2N2O2 and a molecular weight of 223.13 g/mol. IUPAC name: (2R)-2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;dihydrochloride. InChIKey: JBBURJFZIMRPCZ-AYBNVTFNSA-N.
| Molecular formula | C6H16Cl2N2O2 |
|---|---|
| Molecular weight | 223.13 g/mol |
| IUPAC name | (2R)-2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;dihydrochloride |
| InChIKey | JBBURJFZIMRPCZ-AYBNVTFNSA-N |
| SMILES | [2H]C([2H])(C[C@H](C(=O)O)N)C([2H])([2H])CN.Cl.Cl |
Computed by PubChem (NCBI)