CAS 40216-82-8 appears in our catalog under these names: H–Orn–OMe·2HCl, H-L-Orn-OMe*2HCl, H-Orn-OMe·2HCl 97%, H-Orn-OMe.2HCl, 98%, 98%, (S)-Methyl 2,5-diaminopentanoate dihydrochloride, 97%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 500g, 1000g, 1g.
Methyl (2S)-2,5-diaminopentanoate;dihydrochloride (CAS 40216-82-8) is a chemical compound with the molecular formula C6H16Cl2N2O2 and a molecular weight of 219.11 g/mol. IUPAC name: methyl (2S)-2,5-diaminopentanoate;dihydrochloride. InChIKey: SNFZNVWAQDVFAK-XRIGFGBMSA-N.
| Molecular formula | C6H16Cl2N2O2 |
|---|---|
| Molecular weight | 219.11 g/mol |
| IUPAC name | methyl (2S)-2,5-diaminopentanoate;dihydrochloride |
| InChIKey | SNFZNVWAQDVFAK-XRIGFGBMSA-N |
| SMILES | COC(=O)[C@H](CCCN)N.Cl.Cl |
Computed by PubChem (NCBI)