Products 2747-89-9
CAS 2747-89-9 appears in our catalog under these names: DL-Lysine-2-15N 2HCl, 99 atom % 15N, min 98% Chemical Purity, DL-Lysine2-15N (dihydrochloride). Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 1mg, 5mg.
6-amino-2-(15N)azanylhexanoic acid;dihydrochloride (CAS 2747-89-9) is a chemical compound with the molecular formula C6H16Cl2N2O2 and a molecular weight of 220.10 g/mol. IUPAC name: 6-amino-2-(15N)azanylhexanoic acid;dihydrochloride. InChIKey: JBBURJFZIMRPCZ-IAAMHKOASA-N.
| Molecular formula | C6H16Cl2N2O2 |
|---|---|
| Molecular weight | 220.10 g/mol |
| IUPAC name | 6-amino-2-(15N)azanylhexanoic acid;dihydrochloride |
| InChIKey | JBBURJFZIMRPCZ-IAAMHKOASA-N |
| SMILES | C(CCN)CC(C(=O)O)[15NH2].Cl.Cl |
Computed by PubChem (NCBI)