Products 2708341-49-3
CAS 2708341-49-3 is the registry number for D-Lysine-3,3,4,4,5,5,6,6-d8 2HCl, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
(2R)-2,6-diamino-3,3,4,4,5,5,6,6-octadeuteriohexanoic acid;dihydrochloride (CAS 2708341-49-3) is a chemical compound with the molecular formula C6H16Cl2N2O2 and a molecular weight of 227.16 g/mol. IUPAC name: (2R)-2,6-diamino-3,3,4,4,5,5,6,6-octadeuteriohexanoic acid;dihydrochloride. InChIKey: JBBURJFZIMRPCZ-SDYKFIRESA-N.
| Molecular formula | C6H16Cl2N2O2 |
|---|---|
| Molecular weight | 227.16 g/mol |
| IUPAC name | (2R)-2,6-diamino-3,3,4,4,5,5,6,6-octadeuteriohexanoic acid;dihydrochloride |
| InChIKey | JBBURJFZIMRPCZ-SDYKFIRESA-N |
| SMILES | [2H]C([2H])([C@H](C(=O)O)N)C([2H])([2H])C([2H])([2H])C([2H])([2H])N.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
D-Lysine-d8 (dihydrochloride)