CAS 103058-59-9 appears in our catalog under these names: 1-(2-Chlorophenyl)-5-methyl-1H-1,2,4-triazole-3-carboxylic acid, 95%, 1-(2-Chlorophenyl)-5-methyl-1H-1,2,4-triazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1-(2-chlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid (CAS 103058-59-9) is a chemical compound with the molecular formula C10H8ClN3O2 and a molecular weight of 237.64 g/mol. IUPAC name: 1-(2-chlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid. InChIKey: WJNAOSHNSBEKEB-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O2 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid |
| InChIKey | WJNAOSHNSBEKEB-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1C2=CC=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)