CAS 103058-62-4 appears in our catalog under these names: 1-(4-Fluorophenyl)-5-methyl-1h-1,2,4-triazole-3-carboxylic acid, 95%, 1-(4-Fluorophenyl)-5-methyl-1H-1,2,4-triazole-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid (CAS 103058-62-4) is a chemical compound with the molecular formula C10H8FN3O2 and a molecular weight of 221.19 g/mol. IUPAC name: 1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid. InChIKey: IOKWGFCAXYAKKM-UHFFFAOYSA-N.
| Molecular formula | C10H8FN3O2 |
|---|---|
| Molecular weight | 221.19 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid |
| InChIKey | IOKWGFCAXYAKKM-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)