CAS 18507-17-0 is the registry number for 6-Amino-1-(2-fluoro-phenyl)-1h-pyrimidine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
6-amino-1-(2-fluorophenyl)pyrimidine-2,4-dione (CAS 18507-17-0) is a chemical compound with the molecular formula C10H8FN3O2 and a molecular weight of 221.19 g/mol. IUPAC name: 6-amino-1-(2-fluorophenyl)pyrimidine-2,4-dione. InChIKey: UULFXQHUGLVQMA-UHFFFAOYSA-N.
| Molecular formula | C10H8FN3O2 |
|---|---|
| Molecular weight | 221.19 g/mol |
| IUPAC name | 6-amino-1-(2-fluorophenyl)pyrimidine-2,4-dione |
| InChIKey | UULFXQHUGLVQMA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=CC(=O)NC2=O)N)F |
Computed by PubChem (NCBI)