Products 618091-61-5
CAS 618091-61-5 appears in our catalog under these names: 5-Amino-1-(2-fluorophenyl)-1h-pyrazole-4-carboxylic acid, 95%, 5-Amino-1-(2-fluorophenyl)-1H-pyrazole-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
5-amino-1-(2-fluorophenyl)pyrazole-4-carboxylic acid (CAS 618091-61-5) is a chemical compound with the molecular formula C10H8FN3O2 and a molecular weight of 221.19 g/mol. IUPAC name: 5-amino-1-(2-fluorophenyl)pyrazole-4-carboxylic acid. InChIKey: ZHBRRQXKEBSCBS-UHFFFAOYSA-N.
| Molecular formula | C10H8FN3O2 |
|---|---|
| Molecular weight | 221.19 g/mol |
| IUPAC name | 5-amino-1-(2-fluorophenyl)pyrazole-4-carboxylic acid |
| InChIKey | ZHBRRQXKEBSCBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=C(C=N2)C(=O)O)N)F |
Computed by PubChem (NCBI)