Products 106308-42-3

CAS 106308-42-3 is the registry number for 1-(2-Fluorobenzyl)-1h-1,2,3-triazole-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

1-[(2-fluorophenyl)methyl]triazole-4-carboxylic acid (CAS 106308-42-3) is a chemical compound with the molecular formula C10H8FN3O2 and a molecular weight of 221.19 g/mol. IUPAC name: 1-[(2-fluorophenyl)methyl]triazole-4-carboxylic acid. InChIKey: QOQJFBGZXPUNOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8FN3O2
Molecular weight221.19 g/mol
IUPAC name1-[(2-fluorophenyl)methyl]triazole-4-carboxylic acid
InChIKeyQOQJFBGZXPUNOZ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)CN2C=C(N=N2)C(=O)O)F

Computed by PubChem (NCBI)