CAS 887035-85-0 appears in our catalog under these names: 1-(2-Fluorophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid, 98%, 1-(2-Fluorophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid, 1-(2-Fluorophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid 97%, 1-(2-Fluorophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid, 98%, 98%, 1-(2-Fluoro-phenyl)-5-methyl-1H-[1,2,3]triazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 500mg.
1-(2-fluorophenyl)-5-methyltriazole-4-carboxylic acid (CAS 887035-85-0) is a chemical compound with the molecular formula C10H8FN3O2 and a molecular weight of 221.19 g/mol. IUPAC name: 1-(2-fluorophenyl)-5-methyltriazole-4-carboxylic acid. InChIKey: HOCYRMQMIPAWLX-UHFFFAOYSA-N.
| Molecular formula | C10H8FN3O2 |
|---|---|
| Molecular weight | 221.19 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-5-methyltriazole-4-carboxylic acid |
| InChIKey | HOCYRMQMIPAWLX-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)