CAS 889939-73-5 appears in our catalog under these names: 1-(4-Fluorobenzyl)-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-(4-Fluorobenzyl)-1H-1,2,3-triazole-4-carboxylic acid, 98%, 1-((4-Fluorophenyl)methyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 0,5g, 50mg.
1-[(4-fluorophenyl)methyl]triazole-4-carboxylic acid (CAS 889939-73-5) is a chemical compound with the molecular formula C10H8FN3O2 and a molecular weight of 221.19 g/mol. IUPAC name: 1-[(4-fluorophenyl)methyl]triazole-4-carboxylic acid. InChIKey: RMWPNKWXZUADBT-UHFFFAOYSA-N.
| Molecular formula | C10H8FN3O2 |
|---|---|
| Molecular weight | 221.19 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)methyl]triazole-4-carboxylic acid |
| InChIKey | RMWPNKWXZUADBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=C(N=N2)C(=O)O)F |
Computed by PubChem (NCBI)