CAS 887035-89-4 appears in our catalog under these names: 1–(4–Fluorophenyl)–5–methyl–1,2,3–triazole–4–carboxylic Acid, 1-(4-Fluoro-phenyl)-5-methyl-1h-(1,2,3)triazole-4-carboxylic acid, 1-(4-Fluoro-phenyl)-5-methyl-1H-[1,2,3]triazole-4-carboxylic acid, 1-(4-Fluoro-phenyl)-5-methyl-1h-[1,2,3]triazole-4-carboxylic acid, 95%, 1-(4-Fluorophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid, >97%, >97%. Offered by: GLPBio, Biosynth, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, 100mg.
1-(4-fluorophenyl)-5-methyltriazole-4-carboxylic acid (CAS 887035-89-4) is a chemical compound with the molecular formula C10H8FN3O2 and a molecular weight of 221.19 g/mol. IUPAC name: 1-(4-fluorophenyl)-5-methyltriazole-4-carboxylic acid. InChIKey: AEXWTPJOQWLAFH-UHFFFAOYSA-N.
| Molecular formula | C10H8FN3O2 |
|---|---|
| Molecular weight | 221.19 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-5-methyltriazole-4-carboxylic acid |
| InChIKey | AEXWTPJOQWLAFH-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)