CAS 10313-27-6 appears in our catalog under these names: 5-Phenyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid, 95%, 5-Phenyl-4,5-dihydroisoxazole-3-carboxylic acid, 95+%, 5–Phenyl–4,5–dihydroisoxazole–3–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg.
5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid (CAS 10313-27-6) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid. InChIKey: VRODIKIAQUNGJI-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| InChIKey | VRODIKIAQUNGJI-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)