CAS 1031417-41-0 appears in our catalog under these names: 7-Methyl-1h-indazole-5-carboxylic acid, 95%, 7-Methyl-1H-indazole-5-carboxylic acid, 7-Methyl-1H-indazole-5-carboxylic acid 96%, 1H-Indazole-5-carboxylic acid, 7-methyl-, 96%, 96%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 0,5g.
7-methyl-1H-indazole-5-carboxylic acid (CAS 1031417-41-0) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 7-methyl-1H-indazole-5-carboxylic acid. InChIKey: XMVNTKZCEKCKQD-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 7-methyl-1H-indazole-5-carboxylic acid |
| InChIKey | XMVNTKZCEKCKQD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NN=C2)C(=O)O |
Computed by PubChem (NCBI)