Products 885266-66-0

CAS 885266-66-0 is the registry number for 4-tert-Butoxycarbonylamino-1h-indole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

4-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-indole-3-carboxylic acid (CAS 885266-66-0) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-indole-3-carboxylic acid. InChIKey: QBNHICJNKZTOJB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16N2O4
Molecular weight276.29 g/mol
IUPAC name4-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-indole-3-carboxylic acid
InChIKeyQBNHICJNKZTOJB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=CC=CC2=C1C(=CN2)C(=O)O

Computed by PubChem (NCBI)