CAS 948015-63-2 appears in our catalog under these names: 6-N-Boc-aminoindole-4-carboxylic acid, 95%, 1H–Indole–4–carboxylic acid, 6–(((1,1–diMethylethoxy)carbonyl)aMino)–. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
6-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-indole-4-carboxylic acid (CAS 948015-63-2) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: 6-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-indole-4-carboxylic acid. InChIKey: LXZJJEUIQUAFCF-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O4 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 6-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-indole-4-carboxylic acid |
| InChIKey | LXZJJEUIQUAFCF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C2C=CNC2=C1)C(=O)O |
Computed by PubChem (NCBI)