Products 1033196-18-7
CAS 1033196-18-7 appears in our catalog under these names: 7-Methyl-3-benzofurancarboxylic acid, 98%, 7-Methyl-1-benzofuran-3-carboxylic acid, 7-Methyl-1-benzofuran-3-carboxylic acid, 98%, 7-Methyl-1-benzofuran-3-carboxylic acid, 98%, 98%. Offered by: Fluorochem, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
7-methyl-1-benzofuran-3-carboxylic acid (CAS 1033196-18-7) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: 7-methyl-1-benzofuran-3-carboxylic acid. InChIKey: OJZFKUVTMWYITA-UHFFFAOYSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 7-methyl-1-benzofuran-3-carboxylic acid |
| InChIKey | OJZFKUVTMWYITA-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CO2)C(=O)O |
Computed by PubChem (NCBI)