CAS 103321-49-9 appears in our catalog under these names: Fmoc-Gly-Cl, 95%, Fmoc–Gly–Cl, Fmoc-Gly-Cl 95%, Fmoc-Gly-Cl, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100g.
9H-fluoren-9-ylmethyl N-(2-chloro-2-oxoethyl)carbamate (CAS 103321-49-9) is a chemical compound with the molecular formula C17H14ClNO3 and a molecular weight of 315.7 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2-chloro-2-oxoethyl)carbamate. InChIKey: HFWFBOCOXPEKBV-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO3 |
|---|---|
| Molecular weight | 315.7 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(2-chloro-2-oxoethyl)carbamate |
| InChIKey | HFWFBOCOXPEKBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)Cl |
Computed by PubChem (NCBI)