CAS 3069915-36-9 is the registry number for MAO-B-IN-45. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[(4-chlorophenyl)methoxy]-3-hydroxy-1-methylquinolin-2-one (CAS 3069915-36-9) is a chemical compound with the molecular formula C17H14ClNO3 and a molecular weight of 315.7 g/mol. IUPAC name: 7-[(4-chlorophenyl)methoxy]-3-hydroxy-1-methylquinolin-2-one. InChIKey: WHURMKVVBUVXES-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO3 |
|---|---|
| Molecular weight | 315.7 g/mol |
| IUPAC name | 7-[(4-chlorophenyl)methoxy]-3-hydroxy-1-methylquinolin-2-one |
| InChIKey | WHURMKVVBUVXES-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)OCC3=CC=C(C=C3)Cl)C=C(C1=O)O |
Computed by PubChem (NCBI)