Products 139122-17-1

CAS 139122-17-1 is the registry number for 2-(3-Chloro-2-oxoindolin-4-yl)ethyl benzoate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(3-chloro-2-oxo-1,3-dihydroindol-4-yl)ethyl benzoate (CAS 139122-17-1) is a chemical compound with the molecular formula C17H14ClNO3 and a molecular weight of 315.7 g/mol. IUPAC name: 2-(3-chloro-2-oxo-1,3-dihydroindol-4-yl)ethyl benzoate. InChIKey: QXZUSCSOBQPDPX-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14ClNO3
Molecular weight315.7 g/mol
IUPAC name2-(3-chloro-2-oxo-1,3-dihydroindol-4-yl)ethyl benzoate
InChIKeyQXZUSCSOBQPDPX-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)OCCC2=C3C(C(=O)NC3=CC=C2)Cl

Computed by PubChem (NCBI)