CAS 139122-17-1 is the registry number for 2-(3-Chloro-2-oxoindolin-4-yl)ethyl benzoate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chloro-2-oxo-1,3-dihydroindol-4-yl)ethyl benzoate (CAS 139122-17-1) is a chemical compound with the molecular formula C17H14ClNO3 and a molecular weight of 315.7 g/mol. IUPAC name: 2-(3-chloro-2-oxo-1,3-dihydroindol-4-yl)ethyl benzoate. InChIKey: QXZUSCSOBQPDPX-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO3 |
|---|---|
| Molecular weight | 315.7 g/mol |
| IUPAC name | 2-(3-chloro-2-oxo-1,3-dihydroindol-4-yl)ethyl benzoate |
| InChIKey | QXZUSCSOBQPDPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCCC2=C3C(C(=O)NC3=CC=C2)Cl |
Computed by PubChem (NCBI)