Products 892255-06-0

CAS 892255-06-0 appears in our catalog under these names: 1-(2-(2-Chlorophenoxy)ethyl)-1H-indole-3-carboxylic acid, 95%, 1-(2-(2-Chlorophenoxy)ethyl)-1H-indole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-[2-(2-chlorophenoxy)ethyl]indole-3-carboxylic acid (CAS 892255-06-0) is a chemical compound with the molecular formula C17H14ClNO3 and a molecular weight of 315.7 g/mol. IUPAC name: 1-[2-(2-chlorophenoxy)ethyl]indole-3-carboxylic acid. InChIKey: LHJOKCMLJJDHIM-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14ClNO3
Molecular weight315.7 g/mol
IUPAC name1-[2-(2-chlorophenoxy)ethyl]indole-3-carboxylic acid
InChIKeyLHJOKCMLJJDHIM-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CN2CCOC3=CC=CC=C3Cl)C(=O)O

Computed by PubChem (NCBI)