CAS 859034-27-8 is the registry number for Methyl 2-benzamido-3-(2-chlorophenyl)acrylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (E)-2-benzamido-3-(2-chlorophenyl)prop-2-enoate (CAS 859034-27-8) is a chemical compound with the molecular formula C17H14ClNO3 and a molecular weight of 315.7 g/mol. IUPAC name: methyl (E)-2-benzamido-3-(2-chlorophenyl)prop-2-enoate. InChIKey: ATXAVVDTQDEWFD-RVDMUPIBSA-N.
| Molecular formula | C17H14ClNO3 |
|---|---|
| Molecular weight | 315.7 g/mol |
| IUPAC name | methyl (E)-2-benzamido-3-(2-chlorophenyl)prop-2-enoate |
| InChIKey | ATXAVVDTQDEWFD-RVDMUPIBSA-N |
| SMILES | COC(=O)/C(=C\C1=CC=CC=C1Cl)/NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)