CAS 87498-09-7 is the registry number for Benoxaprofen Methyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.
Methyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate (CAS 87498-09-7) is a chemical compound with the molecular formula C17H14ClNO3 and a molecular weight of 315.7 g/mol. IUPAC name: methyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate. InChIKey: IGCCPQHJCXIHES-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO3 |
|---|---|
| Molecular weight | 315.7 g/mol |
| IUPAC name | methyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate |
| InChIKey | IGCCPQHJCXIHES-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)OC(=N2)C3=CC=C(C=C3)Cl)C(=O)OC |
Computed by PubChem (NCBI)