Products 87498-09-7

CAS 87498-09-7 is the registry number for Benoxaprofen Methyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

Methyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate (CAS 87498-09-7) is a chemical compound with the molecular formula C17H14ClNO3 and a molecular weight of 315.7 g/mol. IUPAC name: methyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate. InChIKey: IGCCPQHJCXIHES-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14ClNO3
Molecular weight315.7 g/mol
IUPAC namemethyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate
InChIKeyIGCCPQHJCXIHES-UHFFFAOYSA-N
SMILESCC(C1=CC2=C(C=C1)OC(=N2)C3=CC=C(C=C3)Cl)C(=O)OC

Computed by PubChem (NCBI)