CAS 1162120-35-5 appears in our catalog under these names: 3-(5-Chloro-2-phenoxyphenyl)-1-methylpyrrolidine-2,4-dione, 98%, 3-(5-Chloro-2-phenoxyphenyl)-1-methylpyrrolidine-2,4-dione, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
3-(5-chloro-2-phenoxyphenyl)-1-methylpyrrolidine-2,4-dione (CAS 1162120-35-5) is a chemical compound with the molecular formula C17H14ClNO3 and a molecular weight of 315.7 g/mol. IUPAC name: 3-(5-chloro-2-phenoxyphenyl)-1-methylpyrrolidine-2,4-dione. InChIKey: LAXTYFZLKJOGDP-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO3 |
|---|---|
| Molecular weight | 315.7 g/mol |
| IUPAC name | 3-(5-chloro-2-phenoxyphenyl)-1-methylpyrrolidine-2,4-dione |
| InChIKey | LAXTYFZLKJOGDP-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)C(C1=O)C2=C(C=CC(=C2)Cl)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)