CAS 1033753-14-8 appears in our catalog under these names: D-Serine, 1,1-dimethylethyl ester Hydrochloride Salt, tert–Butyl D–serinate hydrochloride, D-Serine, 1,1-dimethylethyl ester hydrochloride, H-D-Ser-OtBu·HCl 97%, (R)-tert-Butyl 2-amino-3-hydroxypropanoate hydrochloride, 97%, 97%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 500mg, 1g, 5g, 100mg, 250mg, 10g, 25g.
Tert-butyl (2R)-2-amino-3-hydroxypropanoate;hydrochloride (CAS 1033753-14-8) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. IUPAC name: tert-butyl (2R)-2-amino-3-hydroxypropanoate;hydrochloride. InChIKey: TUDHOGYHZNNYHW-NUBCRITNSA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | tert-butyl (2R)-2-amino-3-hydroxypropanoate;hydrochloride |
| InChIKey | TUDHOGYHZNNYHW-NUBCRITNSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)