Products 1034047-29-4
CAS 1034047-29-4 is the registry number for 4-(1-CYANOCYCLOBUTYL)BENZENESULFONYL CHLORIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-(1-cyanocyclobutyl)benzenesulfonyl chloride (CAS 1034047-29-4) is a chemical compound with the molecular formula C11H10ClNO2S and a molecular weight of 255.72 g/mol. IUPAC name: 4-(1-cyanocyclobutyl)benzenesulfonyl chloride. InChIKey: YQYUBMIYYCGFOU-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2S |
|---|---|
| Molecular weight | 255.72 g/mol |
| IUPAC name | 4-(1-cyanocyclobutyl)benzenesulfonyl chloride |
| InChIKey | YQYUBMIYYCGFOU-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C#N)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)