CAS 857998-13-1 is the registry number for 2-(2-Phenylthiazol-4-yl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(2-phenyl-1,3-thiazol-4-yl)acetic acid;hydrochloride (CAS 857998-13-1) is a chemical compound with the molecular formula C11H10ClNO2S and a molecular weight of 255.72 g/mol. IUPAC name: 2-(2-phenyl-1,3-thiazol-4-yl)acetic acid;hydrochloride. InChIKey: ZZPLBAHRNWFEFF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2S |
|---|---|
| Molecular weight | 255.72 g/mol |
| IUPAC name | 2-(2-phenyl-1,3-thiazol-4-yl)acetic acid;hydrochloride |
| InChIKey | ZZPLBAHRNWFEFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)CC(=O)O.Cl |
Computed by PubChem (NCBI)