CAS 1521982-47-7 is the registry number for 5,7-Dimethylquinoline-8-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5,7-dimethylquinoline-8-sulfonyl chloride (CAS 1521982-47-7) is a chemical compound with the molecular formula C11H10ClNO2S and a molecular weight of 255.72 g/mol. IUPAC name: 5,7-dimethylquinoline-8-sulfonyl chloride. InChIKey: XKZPOMFYOCTBGT-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2S |
|---|---|
| Molecular weight | 255.72 g/mol |
| IUPAC name | 5,7-dimethylquinoline-8-sulfonyl chloride |
| InChIKey | XKZPOMFYOCTBGT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1C=CC=N2)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)