Products 1823505-06-1

CAS 1823505-06-1 is the registry number for (2-Chloro-benzothiazol-6-yl)-acetic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(2-chloro-1,3-benzothiazol-6-yl)acetate (CAS 1823505-06-1) is a chemical compound with the molecular formula C11H10ClNO2S and a molecular weight of 255.72 g/mol. IUPAC name: ethyl 2-(2-chloro-1,3-benzothiazol-6-yl)acetate. InChIKey: LDSBFLRPTGHFAC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10ClNO2S
Molecular weight255.72 g/mol
IUPAC nameethyl 2-(2-chloro-1,3-benzothiazol-6-yl)acetate
InChIKeyLDSBFLRPTGHFAC-UHFFFAOYSA-N
SMILESCCOC(=O)CC1=CC2=C(C=C1)N=C(S2)Cl

Computed by PubChem (NCBI)