CAS 926251-43-6 appears in our catalog under these names: 4-(4-(Chloromethyl)-1,3-thiazol-2-yl)-2-methoxyphenol, 95%, 4-(4-(Chloromethyl)-1,3-thiazol-2-yl)-2-methoxyphenol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
4-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-methoxyphenol (CAS 926251-43-6) is a chemical compound with the molecular formula C11H10ClNO2S and a molecular weight of 255.72 g/mol. IUPAC name: 4-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-methoxyphenol. InChIKey: YVNTZIITHJILNS-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2S |
|---|---|
| Molecular weight | 255.72 g/mol |
| IUPAC name | 4-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-methoxyphenol |
| InChIKey | YVNTZIITHJILNS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=NC(=CS2)CCl)O |
Computed by PubChem (NCBI)