CAS 1188232-54-3 is the registry number for Ethyl 2-(7-chlorobenzo[d]thiazol-2-yl)acetate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(7-chloro-1,3-benzothiazol-2-yl)acetate (CAS 1188232-54-3) is a chemical compound with the molecular formula C11H10ClNO2S and a molecular weight of 255.72 g/mol. IUPAC name: ethyl 2-(7-chloro-1,3-benzothiazol-2-yl)acetate. InChIKey: NVYLQYAANNFMHD-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2S |
|---|---|
| Molecular weight | 255.72 g/mol |
| IUPAC name | ethyl 2-(7-chloro-1,3-benzothiazol-2-yl)acetate |
| InChIKey | NVYLQYAANNFMHD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=NC2=C(S1)C(=CC=C2)Cl |
Computed by PubChem (NCBI)