CAS 881634-13-5 appears in our catalog under these names: Ethyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate, 95%, Ethyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Ethyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate (CAS 881634-13-5) is a chemical compound with the molecular formula C11H10ClNO2S and a molecular weight of 255.72 g/mol. IUPAC name: ethyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate. InChIKey: WQNHAHGRGWWDNO-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2S |
|---|---|
| Molecular weight | 255.72 g/mol |
| IUPAC name | ethyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate |
| InChIKey | WQNHAHGRGWWDNO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=NC2=C(S1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)