Products 262361-60-4

CAS 262361-60-4 is the registry number for Fmoc-N-methyl-DL-valine, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylbutanoic acid (CAS 262361-60-4) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylbutanoic acid. InChIKey: YCXXXPZNQXXRIG-UHFFFAOYSA-N.

Identity
Molecular formulaC21H23NO4
Molecular weight353.4 g/mol
IUPAC name2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylbutanoic acid
InChIKeyYCXXXPZNQXXRIG-UHFFFAOYSA-N
SMILESCC(C)C(C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)