CAS 103733-66-0 appears in our catalog under these names: (S)-1,2,3,4-Tetrahydro-6,7-dimethoxyisoquinoline-3-carboxylic acid, 95%, (S)-1,2,3,4-Tetrahydro-6,7-dimethoxyisoquinoline-3-carboxylic acid, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250mg.
(3S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (CAS 103733-66-0) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (3S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid. InChIKey: BWYXEHBJIMGDEB-VIFPVBQESA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (3S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| InChIKey | BWYXEHBJIMGDEB-VIFPVBQESA-N |
| SMILES | COC1=C(C=C2CN[C@@H](CC2=C1)C(=O)O)OC |
Computed by PubChem (NCBI)