CAS 1038315-36-4 appears in our catalog under these names: 4-N-(4-Methylphenyl)pyridine-3,4-diamine, 4-N-(4-Methylphenyl)pyridine-3,4-diamine, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
4-N-(4-methylphenyl)pyridine-3,4-diamine (CAS 1038315-36-4) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 4-N-(4-methylphenyl)pyridine-3,4-diamine. InChIKey: NTNIVUMTQZQDMU-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 4-N-(4-methylphenyl)pyridine-3,4-diamine |
| InChIKey | NTNIVUMTQZQDMU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=C(C=NC=C2)N |
Computed by PubChem (NCBI)