CAS 1038338-73-6 is the registry number for Methyl 3-amino-3-(3,4-difluorophenyl)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-amino-3-(3,4-difluorophenyl)propanoate (CAS 1038338-73-6) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: methyl 3-amino-3-(3,4-difluorophenyl)propanoate. InChIKey: SNQGXWOBHKSJDZ-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | methyl 3-amino-3-(3,4-difluorophenyl)propanoate |
| InChIKey | SNQGXWOBHKSJDZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC(=C(C=C1)F)F)N |
Computed by PubChem (NCBI)