Products 1038338-84-9
CAS 1038338-84-9 is the registry number for Methyl 3-amino-3-(2,6-dichlorophenyl)propanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-amino-3-(2,6-dichlorophenyl)propanoate (CAS 1038338-84-9) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: methyl 3-amino-3-(2,6-dichlorophenyl)propanoate. InChIKey: NUAPQHIDYSRXCX-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | methyl 3-amino-3-(2,6-dichlorophenyl)propanoate |
| InChIKey | NUAPQHIDYSRXCX-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=C(C=CC=C1Cl)Cl)N |
Computed by PubChem (NCBI)