CAS 1213875-64-9 is the registry number for Methyl (R)-3-amino-3-(2,6-dichlorophenyl)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3R)-3-amino-3-(2,6-dichlorophenyl)propanoate (CAS 1213875-64-9) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: methyl (3R)-3-amino-3-(2,6-dichlorophenyl)propanoate. InChIKey: NUAPQHIDYSRXCX-MRVPVSSYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | methyl (3R)-3-amino-3-(2,6-dichlorophenyl)propanoate |
| InChIKey | NUAPQHIDYSRXCX-MRVPVSSYSA-N |
| SMILES | COC(=O)C[C@H](C1=C(C=CC=C1Cl)Cl)N |
Computed by PubChem (NCBI)