Products 103854-23-5

CAS 103854-23-5 is the registry number for 2-Amino-3-(3,5-dimethylphenyl)propanoic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-amino-3-(3,5-dimethylphenyl)propanoic acid;hydrochloride (CAS 103854-23-5) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: 2-amino-3-(3,5-dimethylphenyl)propanoic acid;hydrochloride. InChIKey: YBISSEMJDVQWHU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO2
Molecular weight229.70 g/mol
IUPAC name2-amino-3-(3,5-dimethylphenyl)propanoic acid;hydrochloride
InChIKeyYBISSEMJDVQWHU-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)CC(C(=O)O)N)C.Cl

Computed by PubChem (NCBI)