CAS 103854-23-5 is the registry number for 2-Amino-3-(3,5-dimethylphenyl)propanoic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-amino-3-(3,5-dimethylphenyl)propanoic acid;hydrochloride (CAS 103854-23-5) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: 2-amino-3-(3,5-dimethylphenyl)propanoic acid;hydrochloride. InChIKey: YBISSEMJDVQWHU-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | 2-amino-3-(3,5-dimethylphenyl)propanoic acid;hydrochloride |
| InChIKey | YBISSEMJDVQWHU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)CC(C(=O)O)N)C.Cl |
Computed by PubChem (NCBI)