Products 103877-89-0

CAS 103877-89-0 is the registry number for 3-Phenoxypyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-phenoxypyridine-2-carboxylic acid (CAS 103877-89-0) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 3-phenoxypyridine-2-carboxylic acid. InChIKey: IBQCJIMAXSKLKT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9NO3
Molecular weight215.20 g/mol
IUPAC name3-phenoxypyridine-2-carboxylic acid
InChIKeyIBQCJIMAXSKLKT-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)OC2=C(N=CC=C2)C(=O)O

Computed by PubChem (NCBI)