CAS 103889-79-8 is the registry number for (R)-2-Amino-2-(2-methoxyphenyl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2R)-2-amino-2-(2-methoxyphenyl)acetic acid;hydrochloride (CAS 103889-79-8) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: (2R)-2-amino-2-(2-methoxyphenyl)acetic acid;hydrochloride. InChIKey: BKBZFMACMXQMMJ-DDWIOCJRSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | (2R)-2-amino-2-(2-methoxyphenyl)acetic acid;hydrochloride |
| InChIKey | BKBZFMACMXQMMJ-DDWIOCJRSA-N |
| SMILES | COC1=CC=CC=C1[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)