CAS 78263-54-4 appears in our catalog under these names: (R)-Amino(4-methoxyphenyl)acetic acid hydrochloride, 96%, (R)-2-Amino-2-(4-methoxyphenyl)acetic acid hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(2R)-2-amino-2-(4-methoxyphenyl)acetic acid;hydrochloride (CAS 78263-54-4) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: (2R)-2-amino-2-(4-methoxyphenyl)acetic acid;hydrochloride. InChIKey: WDELKJOVNVBXIM-DDWIOCJRSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-methoxyphenyl)acetic acid;hydrochloride |
| InChIKey | WDELKJOVNVBXIM-DDWIOCJRSA-N |
| SMILES | COC1=CC=C(C=C1)[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)