CAS 1956317-99-9 is the registry number for Methyl 3-amino-5-methoxybenzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Methyl 3-amino-5-methoxybenzoate;hydrochloride (CAS 1956317-99-9) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: methyl 3-amino-5-methoxybenzoate;hydrochloride. InChIKey: LTQQSTYTHRHVCO-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | methyl 3-amino-5-methoxybenzoate;hydrochloride |
| InChIKey | LTQQSTYTHRHVCO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)N)C(=O)OC.Cl |
Computed by PubChem (NCBI)