CAS 1810074-88-4 appears in our catalog under these names: (S)-2-Amino-3-(2-hydroxyphenyl)propanoic acid hydrochloride, 95%, (S)–2–Amino–3–(2–hydroxyphenyl)propanoic acid hydrochloride, (S)-2-Amino-3-(2-hydroxyphenyl)propanoic acid hydrochloride, 98%, 98%, (S)-2-Amino-3-(2-hydroxyphenyl)propanoic acid hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-3-(2-hydroxyphenyl)propanoic acid;hydrochloride (CAS 1810074-88-4) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: (2S)-2-amino-3-(2-hydroxyphenyl)propanoic acid;hydrochloride. InChIKey: XLWQOLCVHZLDPW-FJXQXJEOSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | (2S)-2-amino-3-(2-hydroxyphenyl)propanoic acid;hydrochloride |
| InChIKey | XLWQOLCVHZLDPW-FJXQXJEOSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)N)O.Cl |
Computed by PubChem (NCBI)