CAS 1269053-30-6 is the registry number for 5-Amino-2-ethoxybenzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
5-amino-2-ethoxybenzoic acid;hydrochloride (CAS 1269053-30-6) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: 5-amino-2-ethoxybenzoic acid;hydrochloride. InChIKey: AKWRKCUJLCVFNI-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 5-amino-2-ethoxybenzoic acid;hydrochloride |
| InChIKey | AKWRKCUJLCVFNI-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)