CAS 134722-07-9 appears in our catalog under these names: Amino(4-methoxyphenyl)acetic acid hydrochloride, 98%, 2-Amino-2-(4-methoxyphenyl)acetic acid hydrochloride, 97%, 2–Amino–2–(4–methoxyphenyl)acetic acid hydrochloride, 2-Amino-2-(4-methoxyphenyl)acetic acid hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 25g, 10g, 100g, 5g.
2-amino-2-(4-methoxyphenyl)acetic acid;hydrochloride (CAS 134722-07-9) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: 2-amino-2-(4-methoxyphenyl)acetic acid;hydrochloride. InChIKey: WDELKJOVNVBXIM-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 2-amino-2-(4-methoxyphenyl)acetic acid;hydrochloride |
| InChIKey | WDELKJOVNVBXIM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)