CAS 179814-91-6 appears in our catalog under these names: Methyl 2-amino-2-(3-hydroxyphenyl)acetate hydrochloride, 95%, Methyl 2-amino-2-(3-hydroxyphenyl)acetate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g, 50mg.
Methyl 2-amino-2-(3-hydroxyphenyl)acetate;hydrochloride (CAS 179814-91-6) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: methyl 2-amino-2-(3-hydroxyphenyl)acetate;hydrochloride. InChIKey: QHOGBTIFQCZFPT-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | methyl 2-amino-2-(3-hydroxyphenyl)acetate;hydrochloride |
| InChIKey | QHOGBTIFQCZFPT-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=CC=C1)O)N.Cl |
Computed by PubChem (NCBI)